For research use only. Not for therapeutic Use.
L-Aspartic acid disodium（Cat No.:I043278）is the disodium salt of L-aspartic acid, an amino acid involved in various metabolic processes, including the synthesis of proteins and neurotransmitters. The disodium form improves the solubility of L-aspartic acid in water, making it more bioavailable for use in biological studies and applications. It plays a role in the urea cycle and is an important intermediate in the synthesis of other amino acids and compounds like purines and pyrimidines. L-Aspartic acid disodium is used in biochemical research, clinical nutrition, and as a component in some dietary supplements for its potential benefits in energy production and brain function.
| CAS Number | 5598-53-8 |
| Synonyms | disodium;(2S)-2-aminobutanedioate |
| Molecular Formula | C4H5NNa2O4 |
| Purity | ≥95% |
| IUPAC Name | disodium;(2S)-2-aminobutanedioate |
| InChI | InChI=1S/C4H7NO4.2Na/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);;/q;2*+1/p-2/t2-;;/m0../s1 |
| InChIKey | XMXOIHIZTOVVFB-JIZZDEOASA-L |
| SMILES | C([C@@H](C(=O)[O-])N)C(=O)[O-].[Na+].[Na+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
