For research use only. Not for therapeutic Use.
L-Balenine is a naturally occurring dipeptide composed of beta-alanine and histidine, found in muscle tissues. Known for its antioxidant properties and ability to buffer lactic acid, it helps improve muscle endurance and reduce fatigue. L-Balenine is of interest in sports nutrition and physiological research for its potential to enhance athletic performance and support muscle recovery.
| Catalog Number | R034144 |
| CAS Number | 331-38-4 |
| Synonyms | Balenine, L-N-β-Alanyl-1-methylhistidine; β-Alanyl-1-methyl-L-histidine; N-β-Alanyl-1-methyl-L-histidine |
| Molecular Formula | C10H16N4O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-aminopropanoyl (2S)-2-amino-3-(1-methylimidazol-4-yl)propanoate |
| InChI | InChI=1S/C10H16N4O3/c1-14-5-7(13-6-14)4-8(12)10(16)17-9(15)2-3-11/h5-6,8H,2-4,11-12H2,1H3/t8-/m0/s1 |
| InChIKey | QAWKDPXGVJMDHM-QMMMGPOBSA-N |
| SMILES | CN1C=C(N=C1)CC(C(=O)OC(=O)CCN)N |
