For research use only. Not for therapeutic Use.
L-Canaline(Cat No.:I011818)is a non-protein amino acid derived from certain leguminous plants, including jack beans. It acts as an analog of the amino acid ornithine and exhibits potent biological activity, primarily as an inhibitor of ornithine aminotransferase, an enzyme involved in amino acid metabolism. L-Canaline’s inhibition of this enzyme disrupts the urea cycle, leading to toxic effects in certain insects and pathogens, which has spurred interest in its potential as a natural pesticide. Additionally, L-Canaline is studied for its cytotoxic properties, which may have applications in cancer research and drug development.
CAS Number | 496-93-5 |
Synonyms | O-amino-L-homoserine; (2S)-2-amino-4-(aminooxy)butanoic acid |
Molecular Formula | C4H10N2O3 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | (2S)-2-amino-4-aminooxybutanoic acid |
InChI | InChI=1S/C4H10N2O3/c5-3(4(7)8)1-2-9-6/h3H,1-2,5-6H2,(H,7,8)/t3-/m0/s1 |
InChIKey | FQPGMQABJNQLLF-VKHMYHEASA-N |
SMILES | C(CON)C(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |