For research use only. Not for therapeutic Use.
L-Carnosine is a dipeptide composed of beta-alanine and histidine, widely used in biochemical and medical research. Known for its antioxidant and anti-glycation properties, it plays a crucial role in cellular protection and aging studies. This compound is essential for investigating metabolic pathways, therapeutic potentials, and the mechanisms of aging, ensuring precise and reliable results in advanced scientific research.
CAS Number | 305-84-0 |
Synonyms | N-(β-Alanyl)-L-histidine; NSC 524045; Sevitin; β-Alanyl-L-histidine; β-Alanylhistidine; Carnosine; 2: PN: WO2009033754 PAGE: 98 Claimed Protein; Dragosine; Ignotin; Ignotine; Karnozin; β-Alanyl-L-histidine |
Molecular Formula | C9H14N4O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | (2S)-2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid |
InChI | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1 |
InChIKey | CQOVPNPJLQNMDC-ZETCQYMHSA-N |
SMILES | C1=C(NC=N1)CC(C(=O)O)NC(=O)CCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |