L-Citrulline-13C（Cat No.:S000598） is a specialized form of citrulline, a non-proteinogenic amino acid involved in the urea cycle and nitric oxide metabolism. The “13C” notation signifies that one or more carbon atoms in the citrulline molecule are replaced with the stable carbon isotope carbon-13. This isotopic labeling facilitates the precise tracking of citrulline metabolism and its incorporation into various biochemical pathways using advanced analytical techniques like mass spectrometry and nuclear magnetic resonance spectroscopy. L-Citrulline-13C is invaluable for studying nitrogen metabolism, assessing renal function, and investigating the role of citrulline in conditions such as cardiovascular disease and urea cycle disorders.
| Catalog Number | S000598 |
| CAS Number | 94740-46-2 |
| Molecular Formula | 13CC5H13N3O3 |
| Purity | 95% |
| IUPAC Name | (2S)-2-amino-5-(aminocarbonylamino)pentanoic acid |
| InChI | InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m0/s1/i6+1 |
| InChIKey | RHGKLRLOHDJJDR-JGTYJTGKSA-N |
| SMILES | C(CC(C(=O)O)N)CNC(=O)N |
