For research use only. Not for therapeutic Use.
L-citrulline-d6(Cat No.:S000666) is a deuterated form of L-citrulline, where six hydrogen atoms are replaced with deuterium, enhancing its molecular stability. This modification makes it an excellent internal standard for precise analytical methods such as mass spectrometry and NMR spectroscopy. L-Citrulline is a key amino acid involved in the urea cycle, which helps in removing ammonia from the body and plays a vital role in nitric oxide synthesis and vasodilation. The introduction of deuterium in L-Citrulline-d6 allows for more accurate pharmacokinetic and metabolic studies, providing deeper insights into its role in biological systems and its therapeutic potential.
Catalog Number | S000666 |
CAS Number | 1331908-61-2 |
Molecular Formula | C6H7D6N3O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-amino-5-(carbamoylamino)-3,3,4,4,5,5-hexadeuteriopentanoic acid |
InChI | InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m0/s1/i1D2,2D2,3D2 |
InChIKey | RHGKLRLOHDJJDR-UJSKYATRSA-N |
SMILES | C(CC(C(=O)O)N)CNC(=O)N |