For research use only. Not for therapeutic Use.
L-Citrulline-d7(Cat No.:S000616) is a deuterium-labeled variant of the amino acid citrulline, where seven hydrogen atoms are replaced with deuterium (D), significantly enhancing its stability and detection capabilities in analytical studies. Citrulline plays a key role in the urea cycle, helping to eliminate ammonia from the body, and in promoting nitric oxide production, which supports blood flow and cardiovascular health. L-Citrulline-d7 is extensively used in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy to investigate these physiological processes, providing valuable insights into citrulline’s metabolic pathways and its potential therapeutic uses.
CAS Number | 2483831-24-7 |
Molecular Formula | C6H6D7N3O3 |
Purity | ≥95% |
IUPAC Name | 2-amino-5-(carbamoylamino)-2,3,3,4,4,5,5-heptadeuteriopentanoic acid |
InChI | InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/i1D2,2D2,3D2,4D |
InChIKey | RHGKLRLOHDJJDR-VNEWRNQKSA-N |
SMILES | C(CC(C(=O)O)N)CNC(=O)N |