For research use only. Not for therapeutic Use.
L-(+)-Cystathionine is a naturally occurring amino acid derivative essential in the transsulfuration pathway of sulfur amino acid metabolism. It plays a pivotal role in the synthesis of cysteine, a precursor to glutathione, a key antioxidant. This compound is valuable for biochemical and pharmacological studies, particularly in the context of homocysteine metabolism and its implications in cardiovascular diseases. L-(+)-Cystathionine is also used in research related to sulfur-containing compounds and their role in cellular redox balance and metabolic processes.
CAS Number | 56-88-2 |
Synonyms | S-[(2R)-2-Amino-2-carboxyethyl]-L-homocysteine; [R-(R*,S*)]-2-Amino-4-[(2-amino-2-carboxyethyl)thio]butanoic Acid; |
Molecular Formula | C7H14N2O4S |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-4-[(2R)-2-amino-2-carboxyethyl]sulfanylbutanoic acid |
InChI | InChI=1S/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1 |
InChIKey | ILRYLPWNYFXEMH-WHFBIAKZSA-N |
SMILES | C(CSCC(C(=O)O)N)C(C(=O)O)N |