is a labeled version of L-cysteine, where the three carbon atoms are enriched with carbon-13, enhancing its detectability for use in analytical methods such as NMR spectroscopy and mass spectrometry. This isotopic labeling is especially valuable for studying the metabolic pathways and biochemical roles of cysteine, a sulfur-containing amino acid critical for protein synthesis, detoxification, and antioxidant defense mechanisms. The carbon-13 labeling allows precise tracing of cysteine’s involvement in cellular processes, offering detailed insights into its behavior, stability, and interaction within various biological systems.
Catalog Number | S000661 |
CAS Number | 202114-66-7 |
Molecular Formula | 13C3H7NO2S |
Purity | 95% |
IUPAC Name | (2R)-2-azaniumyl-3-sulfanylpropanoate |
InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 |
InChIKey | XUJNEKJLAYXESH-REOHCLBHSA-N |
SMILES | C(C(C(=O)[O-])[NH3+])S |