For research use only. Not for therapeutic Use.
L-Cysteine-13C3,15N(Cat No.:S000593) is a specialized form of cysteine, a semi-essential amino acid crucial for protein structure, antioxidant defense, and various metabolic processes. The “13C3,15N” notation indicates that three carbon atoms and all nitrogen atoms in the cysteine molecule are replaced with the stable isotopes carbon-13 and nitrogen-15, respectively. This isotopic labeling facilitates precise tracing of cysteine metabolism and its incorporation into proteins and other biomolecules using advanced analytical techniques like mass spectrometry.
Catalog Number | S000593 |
CAS Number | 202406-97-1 |
Molecular Formula | 13C3H7 15NO2S |
Purity | ≥95% |
IUPAC Name | (2S)-2-(15N)azanyl-3-sulfanyl(1,2,3-13C3)propanoic acid |
InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m1/s1/i1+1,2+1,3+1,4+1 |
InChIKey | XUJNEKJLAYXESH-ROQAEYOOSA-N |
SMILES | C(C(C(=O)O)N)S |