L-Cysteine-15N（Cat No.:S000681） is a labeled form of L-cysteine where the nitrogen atom is enriched with nitrogen-15, enhancing its detectability in analytical methods such as NMR spectroscopy and mass spectrometry. This labeling is particularly useful for studying nitrogen metabolism and protein synthesis involving cysteine, a sulfur-containing amino acid essential for making proteins, supporting detoxification, and acting as an antioxidant. The 15N enrichment allows for detailed tracking and analysis of L-cysteine’s role and transformations in biological systems, providing crucial insights into its involvement in biochemical processes and its behavior in physiological contexts.
| Catalog Number | S000681 |
| CAS Number | 204523-09-1 |
| Molecular Formula | C3H715NO2S |
| Purity | 95% |
| IUPAC Name | (2R)-2-(15N)azanyl-3-sulfanylpropanoic acid |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1/i4+1 |
| InChIKey | XUJNEKJLAYXESH-GZPBOPPUSA-N |
| SMILES | C(C(C(=O)O)N)S |
