For research use only. Not for therapeutic Use.
L-Cysteine-15N,d3 is an isotopically labeled form of the amino acid L-cysteine, where the nitrogen atom is replaced with nitrogen-15 and three hydrogen atoms are replaced with deuterium. This compound is particularly useful in biochemical and medical research for studying protein structure, function, and metabolism, as well as the synthesis of glutathione and other sulfur-containing biomolecules. The incorporation of both nitrogen-15 and deuterium allows for precise tracking in mass spectrometry and NMR spectroscopy, making L-Cysteine-15N,d3 ideal for metabolic tracing studies, isotope dilution analysis, and the investigation of enzyme kinetics. This compound is essential for research in areas such as oxidative stress, cellular signaling, and the development of therapies targeting disorders involving sulfur metabolism, providing reliable and detailed data for scientific investigations.
CAS Number | 1795787-05-1 |
Synonyms | (R)-2-Amino-3-mercaptopropanoic Acid-15N,d3; (R)-Cysteine-15N,d3; 2-Amino-3-mercaptopropionic Acid-15N,d3; Cystein-15N,d3; Cysteine-15N,d3; E 920-15N,d3; Half-cystine-15N,d3; L-(+)-Cysteine-15N,d3; 3-Mercapto-L-alanine-15N,d3; L-Cys-15N,d3; NSC 8746- |
Molecular Formula | C₃H₄D₃¹⁵NO₂S |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (2R)-2-(15N)azanyl-2,3,3-trideuterio-3-sulfanylpropanoic acid |
InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1/i1D2,2D,4+1 |
InChIKey | XUJNEKJLAYXESH-KIYJLCFFSA-N |
SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])S)[15NH2] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |