L-Cysteine-3-13C(Cat No.:S000628) is a stable isotope-labeled form of the amino acid cysteine, where the third carbon atom is enriched with carbon-13 (13C). This specific labeling is valuable for tracing the metabolic pathways of cysteine using mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. It helps researchers study cysteine’s role in protein synthesis, detoxification, and antioxidant defense mechanisms within cells. By using L-Cysteine-3-13C, scientists can gain deeper insights into how cysteine contributes to glutathione production and sulfhydryl group activities, crucial for maintaining cellular health and managing oxidative stress.
Catalog Number | S000628 |
CAS Number | 201612-57-9 |
Molecular Formula | C213CH7NO2S |
Purity | 95% |
IUPAC Name | (2R)-2-amino-3-sulfanyl(313C)propanoic acid |
InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1/i1+1 |
InChIKey | XUJNEKJLAYXESH-IJGDANSWSA-N |
SMILES | C(C(C(=O)O)N)S |