For research use only. Not for therapeutic Use.
L-Cysteine-d3(Cat No.:S000682) is a deuterated form of L-cysteine, where three hydrogen atoms are replaced with deuterium, enhancing its molecular stability and making it particularly valuable as an internal standard for analytical methods such as mass spectrometry and NMR spectroscopy. L-cysteine is a sulfur-containing amino acid important for protein synthesis, detoxification, and antioxidant defense mechanisms within the body. The incorporation of deuterium in L-Cysteine-d3 allows for more precise pharmacokinetic and metabolic studies, providing clearer insights into cysteine’s role and behavior in various biochemical and physiological processes.
CAS Number | 214782-32-8 |
Molecular Formula | C3H4D3NO2S |
Purity | ≥95% |
IUPAC Name | (2R)-2-amino-2,3,3-trideuterio-3-sulfanylpropanoic acid |
InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1/i1D2,2D |
InChIKey | XUJNEKJLAYXESH-RBXBQAPRSA-N |
SMILES | C(C(C(=O)O)N)S |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |