For research use only. Not for therapeutic Use.
L-Cystine-d4(Cat No.:S000624) is a deuterium-labeled version of cystine, where four hydrogen atoms are replaced with deuterium (D), enhancing its detection and stability for analytical purposes in scientific studies. Cystine, the oxidized dimer form of the amino acid cysteine, plays a crucial role in protein structure through disulfide bond formation. Utilizing L-Cystine-d4 in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy allows researchers to explore its involvement in maintaining cellular redox states and protein folding. This isotope labeling is valuable for understanding cystine’s biochemical pathways and its implications in diseases like cystinuria.
CAS Number | 1192736-38-1 |
Molecular Formula | C6H8D4N2O4S2 |
Purity | ≥95% |
IUPAC Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxy-1,1-dideuterioethyl]disulfanyl]-3,3-dideuteriopropanoic acid |
InChI | InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1/i1D2,2D2 |
InChIKey | LEVWYRKDKASIDU-DFMORDAJSA-N |
SMILES | C(C(C(=O)O)N)SSCC(C(=O)O)N |