For research use only. Not for therapeutic Use.
L-Dilinoleoyllecithin(CAT: I014432), also known as dilinoleoylphosphatidylcholine, is a phospholipid molecule composed of two linoleic acid chains esterified to a glycerol backbone, along with a phosphatidylcholine headgroup. It is an essential component of cell membranes and plays a crucial role in various biological processes. L-Dilinoleoyllecithin is known for its emulsifying and surface-active properties, making it useful in pharmaceutical and cosmetic formulations. It is also used as a delivery vehicle for lipophilic drugs and bioactive compounds. Additionally, L-Dilinoleoyllecithin has been studied for its potential health benefits, including its role in improving lipid metabolism and promoting liver health.
CAS Number | 998-06-1 |
Synonyms | L-Dilinoleoyllecithin;;(R)-2,3-bis(((9Z,12Z)-octadeca-9,12-dienoyl)oxy)propyl (2-(trimethylammonio)ethyl) phosphate |
Molecular Formula | C44H80NO8P |
Purity | ≥95% |
Solubility | Soluble in DMSO |
IUPAC Name | [(2R)-2,3-bis[[(9Z,12Z)-octadeca-9,12-dienoyl]oxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
InChI | InChI=1S/C44H80NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-43(46)50-40-42(41-52-54(48,49)51-39-38-45(3,4)5)53-44(47)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,42H,6-13,18-19,24-41H2,1-5H3/b16-14-,17-15-,22-20-,23-21-/t42-/m1/s1 |
InChIKey | FVXDQWZBHIXIEJ-LNDKUQBDSA-N |
SMILES | C[N+](C)(CCOP(OC[C@H](OC(CCCCCCC/C=CC/C=CCCCCC)=O)COC(CCCCCCC/C=CC/C=CCCCCC)=O)([O-])=O)C |
Reference | <br /> |