For research use only. Not for therapeutic Use.
L-DON (L-Donorubicin)(Cat No.:M068413)is a potent derivative of the anthracycline antibiotic daunorubicin, designed to enhance anti-cancer effects while reducing cardiotoxicity. This compound interferes with DNA synthesis in cancer cells by intercalating DNA and inhibiting topoisomerase II, which leads to cell death in rapidly dividing cells. L-DON’s selective action on tumor cells makes it valuable in treating various malignancies, particularly hematologic cancers like leukemia. Research continues into its optimized therapeutic effects, aiming to balance efficacy with reduced side effects in oncology treatment protocols.
CAS Number | 157-03-9 |
Synonyms | DON;NSC 7365 |
Molecular Formula | C₆H₉N₃O₃ |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-6-diazo-5-oxohexanoic acid |
InChI | InChI=1S/C6H9N3O3/c7-5(6(11)12)2-1-4(10)3-9-8/h3,5H,1-2,7H2,(H,11,12)/t5-/m0/s1 |
InChIKey | YCWQAMGASJSUIP-YFKPBYRVSA-N |
SMILES | C(CC(=O)C=[N+]=[N-])[C@@H](C(=O)O)N |