L-(−)-Fucose is a deoxyhexose monosaccharide found on N- and O-linked glycans and glycolipids of a wide variety of organisms. It can exist as a terminal modification of glycan structures or serve as a point of attachment for adding other sugars. In humans, L-(−)-fucose plays a role in A and B blood group antigen substructure determination, selectin-mediated leukocyte-endothelial adhesion, and host-microbe interactions.
| Catalog Number | R004740 |
| CAS Number | 2438-80-4 |
| Synonyms | 6-Deoxy-L-galactose; (-)-Fucose; 6-Deoxy-L-galactose; 6-Desoxygalactose; Fucose; L-(-)-Fucose; L-Galactomethylose; |
| Molecular Formula | C6H12O5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal |
| InChI | InChI=1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4+,5+,6-/m0/s1 |
| InChIKey | PNNNRSAQSRJVSB-KCDKBNATSA-N |
| SMILES | CC(C(C(C(C=O)O)O)O)O |
