For research use only. Not for therapeutic Use.
L-Fucose(CAT: R004740) is a naturally occurring deoxy sugar commonly found in various biological systems, particularly in glycoproteins and glycolipids on cell surfaces. As a constituent of the human microbiome and certain plant and marine organisms, L-Fucose plays a critical role in cell signaling, immune responses, and cellular recognition processes. Its structural uniqueness, lacking a hydroxyl group at the 6-position, makes it an essential component in fucosylation reactions, which are critical for biological recognition and inflammation responses. In research, L-Fucose is widely utilized in glycoscience, where it aids in studying fucosylated glycans involved in cancer, infection, and autoimmune diseases.
CAS Number | 2438-80-4 |
Synonyms | 6-Deoxy-L-galactose; (-)-Fucose; 6-Deoxy-L-galactose; 6-Desoxygalactose; Fucose; L-(-)-Fucose; L-Galactomethylose; |
Molecular Formula | C6H12O5 |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | (2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal |
InChI | InChI=1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4+,5+,6-/m0/s1 |
InChIKey | PNNNRSAQSRJVSB-KCDKBNATSA-N |
SMILES | CC(C(C(C(C=O)O)O)O)O |