L-Glutamic-3-13C Acid（Cat No.:M020095）is a high-purity, isotopically labeled compound essential for advanced biochemical and pharmaceutical research. Featuring a single 13C atom at the third position, this stable isotope-labeled version of L-Glutamic Acid is crucial for studies on amino acid metabolism, neurotransmitter function, and protein synthesis. L-Glutamic-3-13C Acid is a valuable tool for scientific investigations, aiding in drug development and enhancing the understanding of metabolic pathways and biochemical mechanisms.
| Catalog Number | M020095 |
| CAS Number | 115473-51-3 |
| Molecular Formula | C5H9NO4 |
| Purity | 95% |
| Storage | Store at RT |
| IUPAC Name | (2S)-2-amino(313C)pentanedioic acid |
| InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/i1+1 |
| InChIKey | WHUUTDBJXJRKMK-AANACRNLSA-N |
| SMILES | C([13CH2][C@@H](C(=O)O)N)C(=O)O |
