L-glutamic acid-1-13C(Cat No.:S000371) is a labeled form of L-glutamic acid, where the first carbon atom is enriched with the stable isotope carbon-13 (13C). This modification is particularly useful in metabolic research and studies involving carbon tracing in biological systems. L-glutamic acid is an important amino acid that plays a key role in protein synthesis and as a neurotransmitter in the brain. By using 13C labeling, scientists can track the incorporation and distribution of L-glutamic acid in metabolic pathways, helping to elucidate complex biochemical processes and interactions within cells.
Catalog Number | S000371 |
CAS Number | 81201-99-2 |
Molecular Formula | C413CH9NO4 |
Purity | 95% |
IUPAC Name | (2S)-2-amino(113C)pentanedioic acid |
InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/i5+1 |
InChIKey | WHUUTDBJXJRKMK-YTCQKPCCSA-N |
SMILES | C(CC(=O)O)C(C(=O)O)N |