For research use only, not for therapeutic use.
L-Glutamic Acid-13C5,15N（Cat No.:R054001） is a high-purity, isotopically labeled compound essential for cutting-edge biochemical and pharmaceutical research. Featuring five 13C atoms and one 15N atom, this stable isotope-labeled version of L-Glutamic Acid is critical for metabolic pathway analysis, protein synthesis studies, and neurotransmitter research. Its precise labeling enables accurate tracking and quantification in complex biological systems. L-Glutamic Acid-13C5,15N is a valuable tool for scientific investigations, aiding in drug development and enhancing our understanding of metabolic and neurological processes.
| Catalog Number | R054001 |
| CAS Number | 202468-31-3 |
| Synonyms | (2S)-2-Aminopentanedioic Acid-13C5,15N; |
| Molecular Formula | C5H9NO4 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | (2R)-2-(15N)azanyl(1,2,3,4,5-13C5)pentanedioic acid |
| InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m1/s1/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | WHUUTDBJXJRKMK-IGIFWJAOSA-N |
| SMILES | [13CH2]([13CH2][13C](=O)O)[13C@H]([13C](=O)O)[15NH2] |
