For research use only. Not for therapeutic Use.
L-glutamic acid-[3,4-^3H](Cat No.:M096045), commonly referred to as tritiated L-glutamic acid, is a radiolabeled version of the amino acid glutamic acid, where the hydrogen atoms in the 3 and 4 positions have been replaced with tritium (^3H), a radioactive isotope of hydrogen. This modification allows it to be used as a tracer in biochemical assays and medical imaging, particularly in studies of protein synthesis, metabolism, and neurotransmission. Its use helps in understanding glutamic acid’s role in the brain as a key neurotransmitter that influences cognitive functions like learning and memory.
Catalog Number | M096045 |
CAS Number | 147732-35-2 |
Molecular Formula | C5H9NO4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (4S)-4-amino-2,2,3,3-tetratritiopentanedioic acid |
InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/i1T2,2T2 |
InChIKey | WHUUTDBJXJRKMK-WNWDAWGTSA-N |
SMILES | C(CC(=O)O)C(C(=O)O)N |