For research use only. Not for therapeutic Use.
L-glutamic acid-d3(Cat No.:S000700) is a deuterated form of L-glutamic acid, where three hydrogen atoms are replaced with deuterium, enhancing its molecular stability. This feature makes it especially useful as an internal standard for analytical techniques such as mass spectrometry and NMR spectroscopy. L-glutamic acid is a key amino acid involved in protein synthesis and serves as a major neurotransmitter in the brain, facilitating excitatory signals. The introduction of deuterium into L-Glutamic acid-d3 allows for more precise pharmacokinetic and metabolic research, helping to better understand its role and dynamics in biological systems.
Catalog Number | S000700 |
CAS Number | 203805-84-9 |
Molecular Formula | C5H6D3NO4 |
Purity | ≥95% |
IUPAC Name | (2S)-2-amino-2,4,4-trideuteriopentanedioic acid |
InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/i2D2,3D |
InChIKey | WHUUTDBJXJRKMK-KLDZMTGISA-N |
SMILES | C(CC(=O)O)C(C(=O)O)N |