For research use only. Not for therapeutic Use.
L-Glutamic acid potassium salt monohydrate(Cat No.:I042988)is a potassium salt form of L-glutamic acid, an amino acid commonly found in proteins and central to various metabolic processes. The monohydrate form enhances the stability and solubility of the compound. It is often used as a food additive (monosodium glutamate or MSG) for flavor enhancement, providing a savory “umami” taste. In addition to its culinary uses, it plays a role in neurotransmission, supporting brain function. L-Glutamic acid potassium salt is also utilized in research for studying metabolic pathways and amino acid-related disorders.
CAS Number | 6382-01-0 |
Synonyms | potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate |
Molecular Formula | C5H10KNO5 |
Purity | ≥95% |
IUPAC Name | potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate |
InChI | InChI=1S/C5H9NO4.K.H2O/c6-3(5(9)10)1-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);;1H2/q;+1;/p-1/t3-;;/m0../s1 |
InChIKey | XIBUKSQTWSKJMQ-QTNFYWBSSA-M |
SMILES | C(CC(=O)[O-])[C@@H](C(=O)O)N.O.[K+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |