L-Glutamine-1-13C（Cat No.:S000567） is a specialized form of glutamine, a conditionally essential amino acid vital for protein synthesis, energy production, and nucleotide synthesis. The “1-13C” notation indicates that the carbon atom in position 1 of the glutamine molecule is replaced with the stable carbon isotope carbon-13. This isotopic labeling facilitates precise tracking of glutamine metabolism and its incorporation into various biochemical pathways using advanced analytical techniques like mass spectrometry and nuclear magnetic resonance spectroscopy.
| Catalog Number | S000567 |
| CAS Number | 159663-16-8 |
| Molecular Formula | C413CH10N2O3 |
| Purity | 95% |
| IUPAC Name | (2S)-2,5-diamino-5-oxo(113C)pentanoic acid |
| InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1/i5+1 |
| InChIKey | ZDXPYRJPNDTMRX-YTCQKPCCSA-N |
| SMILES | C(CC(=O)N)C(C(=O)O)N |
