L-Glutamine-13C5,15N2（Cat No.:S000612） is a highly labeled variant of the amino acid glutamine, where all five carbon atoms are enriched with carbon-13 (13C) and both nitrogen atoms are replaced with nitrogen-15 (15N). This dual labeling significantly enhances the traceability and analysis of glutamine in biochemical studies using mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. This form of glutamine is crucial for investigating its metabolic roles in protein synthesis, ammonia detoxification, and energy production.
| Catalog Number | S000612 |
| CAS Number | 285978-14-5 |
| Molecular Formula | 13C5H1015N2O3 |
| Purity | 95% |
| IUPAC Name | (2S)-2,5-bis(15N)(azanyl)-5-oxo(1,2,3,4,5-13C5)pentanoic acid |
| InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1 |
| InChIKey | ZDXPYRJPNDTMRX-YIDSDQPMSA-N |
| SMILES | C(CC(=O)N)C(C(=O)O)N |
