For research use only. Not for therapeutic Use.
is an extensively labeled version of L-glutamine, where all five carbon atoms are enriched with carbon-13, both nitrogen atoms with nitrogen-15, and five deuterium atoms replacing specific hydrogen atoms. This triple labeling significantly enhances its detectability and utility in sophisticated analytical techniques such as NMR spectroscopy and mass spectrometry. L-glutamine plays crucial roles in protein synthesis, energy production, and as a nitrogen donor in various metabolic processes. The comprehensive labeling allows for precise, detailed studies of glutamine’s metabolism, transport, and functional contributions within cellular and physiological systems.
| Catalog Number | S000683 |
| CAS Number | 2123439-02-9 |
| Molecular Formula | 13C5H5D515N2O3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| IUPAC Name | (2S)-2,5-bis(15N)(azanyl)-2,3,3,4,4-pentadeuterio-5-oxo(1,2,3,4,5-13C5)pentanoic acid |
| InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1/i1+1D2,2+1D2,3+1D,4+1,5+1,6+1,7+1 |
| InChIKey | ZDXPYRJPNDTMRX-GTWFMKDCSA-N |
| SMILES | C(CC(=O)N)C(C(=O)O)N |
