For research use only. Not for therapeutic Use.
L-Glutamine-15N2(Cat No.:S000569) is a specialized form of glutamine, a conditionally essential amino acid crucial for protein synthesis, nitrogen transport, and nucleotide synthesis. The “15N2” notation indicates that both nitrogen atoms in the glutamine molecule are replaced with the stable nitrogen isotope nitrogen-15. This isotopic labeling facilitates precise tracing of glutamine metabolism and its incorporation into various biochemical pathways using advanced analytical techniques like mass spectrometry and nuclear magnetic resonance spectroscopy.
CAS Number | 204451-48-9 |
Molecular Formula | C5H1015N2O3 |
Purity | ≥95% |
Target | Neuronal Signaling |
IUPAC Name | (2S)-2,5-bis(15N)(azanyl)-5-oxopentanoic acid |
InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1/i6+1,7+1 |
InChIKey | ZDXPYRJPNDTMRX-QLUYOLLXSA-N |
SMILES | C(CC(=O)N)C(C(=O)O)N |