L-Glutamine-15N2（Cat No.:S000569） is a specialized form of glutamine, a conditionally essential amino acid crucial for protein synthesis, nitrogen transport, and nucleotide synthesis. The “15N2” notation indicates that both nitrogen atoms in the glutamine molecule are replaced with the stable nitrogen isotope nitrogen-15. This isotopic labeling facilitates precise tracing of glutamine metabolism and its incorporation into various biochemical pathways using advanced analytical techniques like mass spectrometry and nuclear magnetic resonance spectroscopy.
| Catalog Number | S000569 |
| CAS Number | 204451-48-9 |
| Molecular Formula | C5H1015N2O3 |
| Purity | 95% |
| IUPAC Name | (2S)-2,5-bis(15N)(azanyl)-5-oxopentanoic acid |
| InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1/i6+1,7+1 |
| InChIKey | ZDXPYRJPNDTMRX-QLUYOLLXSA-N |
| SMILES | C(CC(=O)N)C(C(=O)O)N |
