L-Glutamine-5-13C（Cat No.:S000629） is a stable isotope-labeled variant of the amino acid glutamine, where the fifth carbon atom is specifically enriched with carbon-13 (13C). This labeling is essential for detailed studies using techniques like mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy, which track and analyze glutamine’s metabolism in biological systems. L-Glutamine-5-13C allows researchers to investigate glutamine’s role in various cellular processes, including protein synthesis, energy production, and ammonia detoxification. This precise isotope labeling aids in understanding glutamine’s pivotal functions in maintaining cellular metabolism and supporting immune system responses.
| Catalog Number | S000629 |
| CAS Number | 159680-32-7 |
| Molecular Formula | C413CH10N2O3 |
| Purity | 95% |
| IUPAC Name | (2S)-2,5-diamino-5-oxo(513C)pentanoic acid |
| InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1/i4+1 |
| InChIKey | ZDXPYRJPNDTMRX-MYXYCAHRSA-N |
| SMILES | C(CC(=O)N)C(C(=O)O)N |
