For research use only, not for therapeutic use.
L-Glutamine（Cat No.:A000841）is a naturally occurring amino acid essential for various metabolic processes, including protein synthesis, immune function, and intestinal health. It serves as a key fuel source for rapidly dividing cells, such as those in the immune system and the intestinal lining, making it important for maintaining gut integrity and supporting recovery from illness or injury. L-Glutamine is also vital in muscle repair and recovery, especially after intense physical activity. Its role in nitrogen transport helps balance acid-base levels in the body, contributing to overall metabolic stability.
| Catalog Number | A000841 |
| CAS Number | 56-85-9 |
| Synonyms | NA |
| Molecular Formula | C5H10N2O3 |
| Purity | ≥95% |
| Target | mGluR |
| Solubility | >6.2mg/mL in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | (2S)-2,5-diamino-5-oxopentanoic acid |
| InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1 |
| InChIKey | ZDXPYRJPNDTMRX-VKHMYHEASA-N |
| SMILES | C(CC(=O)N)[C@@H](C(=O)O)N |
