For research use only. Not for therapeutic Use.
L-Hexanoylcarnitine-d3 Chloride is a high-purity deuterated compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of L-Hexanoylcarnitine is crucial for studies involving fatty acid metabolism, mitochondrial function, and metabolic pathway analysis. Featuring three deuterium atoms, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for metabolic research and drug development, L-Hexanoylcarnitine-d3 Chloride integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
Catalog Number | S001015 |
CAS Number | 2483831-95-2 |
Molecular Formula | C13H23D3ClNO4 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | [(2R)-3-carboxy-2-hexanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium;chloride |
InChI | InChI=1S/C13H25NO4.ClH/c1-5-6-7-8-13(17)18-11(9-12(15)16)10-14(2,3)4;/h11H,5-10H2,1-4H3;1H/t11-;/m1./s1/i2D3; |
InChIKey | DTHGTKVOSRYXOK-OSGOKLQPSA-N |
SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CCCCC.[Cl-] |