For research use only. Not for therapeutic Use.
L-Homocitrulline(Cat No.:R042833)is a non-proteinogenic amino acid closely related to L-citrulline, used primarily in biochemical and medical research. It is formed by the carbamylation of lysine residues and is a marker for certain metabolic disorders, such as urea cycle defects and rheumatoid arthritis. L-Homocitrulline is also studied for its role in nitric oxide production and vascular health. In research, it is used to investigate protein modifications and their effects on cellular function. Its unique structure makes it valuable for understanding disease mechanisms and potential therapeutic interventions.
CAS Number | 1190-49-4 |
Synonyms | N6-carbamoyl-lysine, ; N6-carbamoyl-L-lysine; Homo-L-citrulline; Homocitrulline; N-ε-Carbamyl-L-lysine; NSC 27428 |
Molecular Formula | C7H15N3O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-amino-6-(carbamoylamino)hexanoic acid |
InChI | InChI=1S/C7H15N3O3/c8-5(6(11)12)3-1-2-4-10-7(9)13/h5H,1-4,8H2,(H,11,12)(H3,9,10,13)/t5-/m0/s1 |
InChIKey | XIGSAGMEBXLVJJ-YFKPBYRVSA-N |
SMILES | C(CCNC(=O)N)CC(C(=O)O)N |