L-Isoleucine-15N（Cat No.:S000605）is a stable isotope-labeled version of the essential amino acid isoleucine, where the nitrogen atom is replaced with nitrogen-15 (15N). This labeling is particularly useful for tracking and analyzing isoleucine’s metabolism and its involvement in protein synthesis using mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. L-Isoleucine-15N helps researchers investigate its role in muscle development and repair, energy production, and regulatory processes within the body.
| Catalog Number | S000605 |
| CAS Number | 59935-30-7 |
| Molecular Formula | C6H1315NO2 |
| Purity | % |
| IUPAC Name | (2S,3S)-2-(15N)azanyl-3-methylpentanoic acid |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1/i7+1 |
| InChIKey | AGPKZVBTJJNPAG-NNXLWEQRSA-N |
| SMILES | CCC(C)C(C(=O)O)N |
