L-Isoleucine-15N,d10（Cat No.:S000632） is a highly specialized stable isotope-labeled form of the amino acid isoleucine, where the nitrogen atom is replaced with nitrogen-15 (15N) and ten hydrogen atoms are substituted with deuterium (D). This dual labeling significantly enhances the molecule’s traceability and stability in scientific investigations, particularly in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. Researchers use L-Isoleucine-15N,d10 to delve into the detailed metabolic and catabolic pathways of isoleucine, exploring its role in muscle metabolism, glucose regulation, and protein synthesis. This helps in understanding isoleucine’s crucial functions in both health and disease.
| Catalog Number | S000632 |
| Molecular Formula | C6H3D1015NO2 |
| Purity | ≥95% |
| IUPAC Name | (2S,3S)-2-(15N)azanyl-2,3,4,4,5,5,5-heptadeuterio-3-(trideuteriomethyl)pentanoic acid |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1/i1D3,2D3,3D2,4D,5D,7+1 |
| InChIKey | AGPKZVBTJJNPAG-JTHQPQSWSA-N |
| SMILES | CCC(C)C(C(=O)O)N |
