For research use only. Not for therapeutic Use.
L-Isoleucine-d10(Cat No.:S000572) is a specialized form of isoleucine, an essential branched-chain amino acid vital for protein synthesis and energy production. The “d10” notation indicates that all ten hydrogen atoms in the isoleucine molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic substitution enables precise tracking of isoleucine metabolism and its incorporation into proteins and other biomolecules using advanced analytical techniques like mass spectrometry.
Catalog Number | S000572 |
CAS Number | 35045-71-7 |
Molecular Formula | C6H3D10NO2 |
Purity | ≥95% |
IUPAC Name | (2S,3S)-2-amino-2,3,4,4,5,5,5-heptadeuterio-3-(trideuteriomethyl)pentanoic acid |
InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1/i1D3,2D3,3D2,4D,5D |
InChIKey | AGPKZVBTJJNPAG-VQWSQZATSA-N |
SMILES | CCC(C)C(C(=O)O)N |