For research use only. Not for therapeutic Use.
L-Kynurenine (CAT: R063147) is a pivotal metabolite in the tryptophan degradation pathway, known as the kynurenine pathway, where it is derived from tryptophan through enzymatic processes. This compound serves as a crucial precursor for the synthesis of various biologically active molecules, including neuroactive and immunomodulatory substances.
CAS Number | 2922-83-0 |
Synonyms | Kynurenine; (αS)-α,2-Diamino-γ-oxo-benzenebutanoic Acid;?L-3-Anthraniloyl-alanine; (S)-α,2-Diamino-γ-oxo-benzenebutanoic Acid; 3-Anthraniloylalanine; Kynurenin; Kynurenine; L-3-(o-Aminobenzoyl)alanine |
Molecular Formula | C10H12N2O3 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | >10.85mg/mL in DMSO |
Storage | Store at RT |
IUPAC Name | (2S)-2-amino-4-(2-aminophenyl)-4-oxobutanoic acid |
InChI | InChI=1S/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15)/t8-/m0/s1 |
InChIKey | YGPSJZOEDVAXAB-QMMMGPOBSA-N |
SMILES | C1=CC=C(C(=C1)C(=O)CC(C(=O)O)N)N |
Reference | 1: Moroni F, Carpenedo R, Chiarugi A. Kynurenine hydroxylase and kynureninase 2: Stone TW, MacGregor DG, Smith RA, Jones P, Behan WM, Graham DI. Basic 3: Freese A, Swartz KJ, During MJ, Martin JB. Kynurenine metabolites of 4: Gál EM, Sherman AD. L-kynurenine: its synthesis and possible regulatory <br> |