L-Lactic acid-13C3（Cat No.:S000764） is a carbon-13 labeled version of L-lactic acid, an important organic acid in biochemical processes, particularly in muscle metabolism during exercise. This compound, with the formula C3^(13)C3H6O3, has all three carbon atoms enriched with the stable isotope carbon-13. This isotopic labeling is crucial for tracking and analyzing metabolic pathways involving lactic acid through techniques like NMR spectroscopy and mass spectrometry. L-Lactic acid-13C3 is extensively used in metabolic research, offering insights into lactic acid’s production, utilization, and role in conditions like lactic acidosis.
| Catalog Number | S000764 |
| CAS Number | 87684-87-5 |
| Molecular Formula | 13C3H6O3 |
| Purity | 95% |
| IUPAC Name | (2S)-2-hydroxy(1,2,3-13C3)propanoic acid |
| InChI | InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m0/s1/i1+1,2+1,3+1 |
| InChIKey | JVTAAEKCZFNVCJ-GCCOVPGMSA-N |
| SMILES | CC(C(=O)O)O |
