L-Leucine-1-13C,15N(Cat No.:S000685) is a labeled form of L-leucine, where the first carbon atom is enriched with carbon-13 and the nitrogen atom with nitrogen-15. This specific isotopic labeling enhances its traceability for sophisticated analytical methods such as NMR spectroscopy and mass spectrometry, making it invaluable for studying protein synthesis and nitrogen metabolism. L-Leucine is an essential branched-chain amino acid crucial for muscle protein synthesis and various metabolic functions. The dual labeling allows precise investigation of leucine’s metabolic pathways, facilitating a deeper understanding of its role in biological processes.
Catalog Number | S000685 |
CAS Number | 80134-83-4 |
Molecular Formula | C513CH1315NO2 |
Purity | 95% |
IUPAC Name | (2S)-2-(15N)azanyl-4-methyl(113C)pentanoic acid |
InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i6+1,7+1 |
InChIKey | ROHFNLRQFUQHCH-XAAHKOKXSA-N |
SMILES | CC(C)CC(C(=O)O)N |