For research use only. Not for therapeutic Use.
is a labeled form of L-leucine, where all six carbon atoms are enriched with carbon-13, enhancing its detectability in analytical studies such as NMR spectroscopy and mass spectrometry. This isotopic labeling is crucial for studying the metabolic pathways and protein synthesis involving leucine, an essential amino acid important for muscle protein synthesis and various metabolic functions. The full carbon-13 labeling of L-Leucine-13C6 allows researchers to trace its incorporation into proteins and understand its role in metabolic processes with greater precision and clarity.
CAS Number | 201740-84-3 |
Molecular Formula | 13C6H13NO2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
IUPAC Name | (2S)-2-amino-4-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid |
InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1 |
InChIKey | ROHFNLRQFUQHCH-IQUPZBQQSA-N |
SMILES | CC(C)CC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |