For research use only. Not for therapeutic Use.
L-Leucine-13C6,15N(Cat No.:S000595) is a specialized form of leucine, an essential amino acid vital for protein synthesis and serving as a signaling molecule in cellular processes. The notation “13C6,15N” specifies that six carbon atoms and all nitrogen atoms in the leucine molecule are replaced with the stable isotopes carbon-13 and nitrogen-15, respectively. This isotopic labeling enables precise tracking of leucine metabolism and its incorporation into proteins using advanced analytical techniques like mass spectrometry and nuclear magnetic resonance spectroscopy.
Catalog Number | S000595 |
CAS Number | 202406-52-8 |
Molecular Formula | 13C6H1315NO2 |
Purity | ≥95% |
IUPAC Name | (2S)-2-(15N)azanyl-4-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid |
InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1 |
InChIKey | ROHFNLRQFUQHCH-HUEJSTCGSA-N |
SMILES | CC(C)CC(C(=O)O)N |