For research use only. Not for therapeutic Use.
L-Leucine-15N(Cat No.:S000570) is a specialized form of leucine, an essential branched-chain amino acid crucial for protein synthesis and cellular metabolism. The “15N” designation indicates that all nitrogen atoms in the leucine molecule are replaced with the stable nitrogen isotope nitrogen-15. This isotopic labeling facilitates precise tracking of leucine metabolism and its incorporation into proteins and other biomolecules using advanced analytical techniques like mass spectrometry and nuclear magnetic resonance spectroscopy.
Catalog Number | S000570 |
CAS Number | 59935-31-8 |
Molecular Formula | C6H1315NO2 |
Purity | ≥95% |
IUPAC Name | (2S)-2-(15N)azanyl-4-methylpentanoic acid |
InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i7+1 |
InChIKey | ROHFNLRQFUQHCH-GEERXGHESA-N |
SMILES | CC(C)CC(C(=O)O)N |