For research use only. Not for therapeutic Use.
L-Leucine-15N（Cat No.:S000570） is a specialized form of leucine, an essential branched-chain amino acid crucial for protein synthesis and cellular metabolism. The “15N” designation indicates that all nitrogen atoms in the leucine molecule are replaced with the stable nitrogen isotope nitrogen-15. This isotopic labeling facilitates precise tracking of leucine metabolism and its incorporation into proteins and other biomolecules using advanced analytical techniques like mass spectrometry and nuclear magnetic resonance spectroscopy.
| CAS Number | 59935-31-8 |
| Molecular Formula | C6H1315NO2 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| IUPAC Name | (2S)-2-(15N)azanyl-4-methylpentanoic acid |
| InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i7+1 |
| InChIKey | ROHFNLRQFUQHCH-GEERXGHESA-N |
| SMILES | CC(C)CC(C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
