For research use only. Not for therapeutic Use.
L-Leucine-d10（Cat No.:S000579） is a specialized form of leucine, a branched-chain essential amino acid crucial for protein synthesis and various metabolic processes. The “d10” designation indicates that all ten hydrogen atoms in the leucine molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic substitution enables precise tracking of leucine metabolism and its incorporation into proteins and other biomolecules using advanced analytical techniques like mass spectrometry and nuclear magnetic resonance spectroscopy.
| Catalog Number | S000579 |
| CAS Number | 106972-44-5 |
| Molecular Formula | C6H3D10NO2 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| IUPAC Name | (2S)-2-amino-2,3,3,4,5,5,5-heptadeuterio-4-(trideuteriomethyl)pentanoic acid |
| InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i1D3,2D3,3D2,4D,5D |
| InChIKey | ROHFNLRQFUQHCH-ZWFPVXGPSA-N |
| SMILES | CC(C)CC(C(=O)O)N |
