For research use only. Not for therapeutic Use.
L-Leucine-d3(Cat No.:R057519) is a high-purity deuterated amino acid featuring three deuterium atoms, essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of L-leucine is crucial for studying protein synthesis, metabolic pathways, and muscle metabolism. Its stable isotope labeling ensures precise and reliable analytical results, making it ideal for applications in NMR spectroscopy, metabolic research, and nutritional studies. The enhanced stability and consistency of L-Leucine-d3 make it suitable for various experimental setups, offering a robust and cost-effective solution for high-precision scientific investigations.
Catalog Number | R057519 |
CAS Number | 87828-86-2 |
Synonyms | (2S)-2-Amino-4-methylpentanoic Acid-d3; (S)-(+)-Leucine-d3; (S)-2-Amino-4-methylpentanoic Acid-d3; (S)-2-Amino-4-methylvaleric Acid-d3; (S)-Leucine-d3; L-(+)-Leucine-d3; L-2-Amino-4-methylpentanoic Acid-d3; L-α-Aminoisocaproic Acid-d3; NSC 46709-d3; |
Molecular Formula | C6H13NO2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-5,5,5-trideuterio-4-methylpentanoic acid |
InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i1D3/t4?,5- |
InChIKey | ROHFNLRQFUQHCH-LONBSJBQSA-N |
SMILES | [2H]C([2H])([2H])C(C)C[C@@H](C(=O)O)N |