For research use only. Not for therapeutic Use.
L-Lysine-13C6,15N2 dihydrochloride（Cat No.:I043638）is a stable isotope-labeled version of the amino acid L-lysine, featuring carbon-13 and nitrogen-15 isotopes for use in advanced research applications. This compound is commonly utilized in metabolic studies, protein labeling, and quantitative proteomics. By incorporating stable isotopes, it allows for precise tracking and identification of lysine residues in complex biological systems. The dihydrochloride salt form enhances the compound’s solubility, making it ideal for experiments involving cell culture or animal models. L-Lysine-13C6,15N2 dihydrochloride is a valuable tool in understanding protein metabolism and cellular processes.
| CAS Number | 202406-54-0 |
| Synonyms | (2S)-2,6-bis(15N)(azanyl)(1,2,3,4,5,6-13C6)hexanoic acid;dihydrochloride |
| Molecular Formula | 13C6H16Cl215N2O2 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2,6-bis(15N)(azanyl)(1,2,3,4,5,6-13C6)hexanoic acid;dihydrochloride |
| InChI | InChI=1S/C6H14N2O2.2ClH/c7-4-2-1-3-5(8)6(9)10;;/h5H,1-4,7-8H2,(H,9,10);2*1H/t5-;;/m0../s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1;; |
| InChIKey | JBBURJFZIMRPCZ-XLWLNXBUSA-N |
| SMILES | [13CH2]([13CH2][13CH2][15NH2])[13CH2][13C@@H]([13C](=O)O)[15NH2].Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
