Home
>
Isotope Labeled Compounds>Isotope Labeled Amino Acids & Peptides> L-Lysine-15N2 hydrochloride
For research use only. Not for therapeutic Use.
L-Lysine-15N2 hydrochloride(Cat No.:S000634) is a stable isotope-labeled version of lysine, where both nitrogen atoms are replaced with nitrogen-15 (15N), formulated as a hydrochloride salt for improved solubility and stability. This labeling is particularly valuable for biochemical and pharmaceutical research, allowing precise tracking of lysine’s metabolism and its role in protein synthesis using mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. L-Lysine-15N2 hydrochloride is crucial for studying lysine’s involvement in various biological processes, including muscle growth, hormone secretion, and immune function, providing insights into health and disease states.
Catalog Number | S000634 |
CAS Number | 1217460-44-0 |
Molecular Formula | C6H15Cl15N2O2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
IUPAC Name | (2S)-2,6-bis(15N)(azanyl)hexanoic acid;hydrochloride |
InChI | InChI=1S/C6H14N2O2.ClH/c7-4-2-1-3-5(8)6(9)10;/h5H,1-4,7-8H2,(H,9,10);1H/t5-;/m0./s1/i7+1,8+1; |
InChIKey | BVHLGVCQOALMSV-XVXIHWTMSA-N |
SMILES | C(CCN)CC(C(=O)O)N.Cl |