L-Lysine-2-13C Hydrochloride（Cat No.:M036242） is a high-purity isotopically labeled compound vital for advanced biochemical and pharmaceutical research. Featuring a carbon-13 atom at the second position, this compound is crucial for studying protein metabolism, amino acid pathways, and stable isotope labeling. It provides enhanced accuracy in mass spectrometry and NMR studies, ensuring reliable and precise analytical results. Ideal for metabolic research, protein synthesis studies, and drug development, L-Lysine-2-13C Hydrochloride integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | M036242 |
| CAS Number | 169524-86-1 |
| Synonyms | L-Lysine-2-13C hydrochloride |
| Molecular Formula | C6H15ClN2O2 |
| Purity | 95% |
| Storage | Store at RT |
| IUPAC Name | (2S)-2,6-diamino(213C)hexanoic acid;hydrochloride |
| InChI | InChI=1S/C6H14N2O2.ClH/c7-4-2-1-3-5(8)6(9)10;/h5H,1-4,7-8H2,(H,9,10);1H/t5-;/m0./s1/i5+1; |
| InChIKey | BVHLGVCQOALMSV-NSINKEICSA-N |
| SMILES | C(CCN)C[13C@@H](C(=O)O)N.Cl |
