For research use only. Not for therapeutic Use.
L-Methionine-13C5(Cat No.:S000591) is a specialized form of methionine, an essential amino acid vital for protein synthesis and various metabolic processes. The notation “13C5” indicates that five carbon atoms in the methionine molecule are replaced with the stable carbon isotope carbon-13. This isotopic labeling facilitates precise tracing of methionine metabolism and its incorporation into proteins and other biomolecules using advanced analytical techniques like mass spectrometry. L-Methionine-13C5 serves as a valuable tool in metabolic studies, allowing researchers to elucidate pathways, understand cellular physiology, and investigate diseases related to methionine metabolism, such as homocystinuria and cardiovascular disease.
CAS Number | 202326-57-6 |
Molecular Formula | 13C5H11NO2S |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-amino-4-(113C)methylsulfanyl(1,2,3,4-13C4)butanoic acid |
InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1/i1+1,2+1,3+1,4+1,5+1 |
InChIKey | FFEARJCKVFRZRR-JRGPAWSWSA-N |
SMILES | CSCCC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |