For research use only. Not for therapeutic Use.
L-Methionine-d3(Cat No.:S000571) is a specialized form of methionine, an essential amino acid crucial for protein synthesis and various metabolic processes. The “d3” notation indicates that three hydrogen atoms in the methionine molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling enables precise tracking of methionine metabolism and its incorporation into proteins and other biomolecules using advanced analytical techniques like mass spectrometry. L-Methionine-d3 serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating diseases related to methionine metabolism, such as homocystinuria and cardiovascular disease.
CAS Number | 13010-53-2 |
Molecular Formula | C5H8D3NO2S |
Purity | ≥95% |
Target | Endogenous Metabolite |
Related CAS | 202326-57-6 73488-65-0 |
IUPAC Name | (2S)-2-amino-4-(trideuteriomethylsulfanyl)butanoic acid |
InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1/i1D3 |
InChIKey | FFEARJCKVFRZRR-OSIBIXDNSA-N |
SMILES | CSCCC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |