For research use only. Not for therapeutic Use.
L-Methionine (Cat.No:R048969) is an essential amino acid vital for protein synthesis and various biochemical processes. It plays a crucial role in the formation of proteins, antioxidants, and molecules like SAM-e. L-Methionine is used in supplements and animal feed to support growth, liver function, and overall health.
Catalog Number | R048969 |
CAS Number | 63-68-3 |
Synonyms | (S)-2-Amino-4-(methylthio)butanoic Acid; Cymethion; S-Methyl-L-momocysteine; L-α-Amino-γ-methylthiobutyric Acid; Methionine; NSC 22946; S-Methionine; S-Methyl-L-homocysteine; h-Met-oh; l-Methionine; α-Amino-γ-methylmercaptobutyric Acid; γ-Methylthio- |
Molecular Formula | C5H11NO2S |
Purity | ≥95% |
Target | NF-κB |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid |
InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
InChIKey | FFEARJCKVFRZRR-BYPYZUCNSA-N |
SMILES | CSCCC(C(=O)O)N |