For research use only. Not for therapeutic Use.
L-Methionylglycine（Cat No.:M065143）is a dipeptide consisting of methionine and glycine. It plays a crucial role in protein synthesis and metabolism, contributing to cellular functions and antioxidant defense. As an essential amino acid derivative, L-Methionylglycine supports the production of vital proteins and enzymes. It is often used in biochemical research, particularly in studies involving peptide synthesis, cellular signaling, and metabolic processes. This compound also holds potential for therapeutic applications in treating conditions related to oxidative stress and amino acid metabolism disorders. Its stability and bioactivity make it valuable for pharmaceutical and cosmetic formulations.
| CAS Number | 14486-03-4 |
| Synonyms | 2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]acetic acid |
| Molecular Formula | C7H14N2O3S |
| Purity | ≥95% |
| IUPAC Name | 2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]acetic acid |
| InChI | InChI=1S/C7H14N2O3S/c1-13-3-2-5(8)7(12)9-4-6(10)11/h5H,2-4,8H2,1H3,(H,9,12)(H,10,11)/t5-/m0/s1 |
| InChIKey | QXOHLNCNYLGICT-YFKPBYRVSA-N |
| SMILES | CSCC[C@@H](C(=O)NCC(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
